molecular-formula - npm Package Compare versions

Comparing version 1.1.4 to 1.1.5

index.js

@@ -5,3 +5,5 @@ var isoAbund = require('isotope-abundances');
   constructor(mf) {
-    this.formula = mf;
+    this.formula = mf.replace(/[⁰¹²³⁴-⁹₀-₉]/g, function(char) {
+      return char.charCodeAt(0).toString(16).slice(-1)
+    });
     var expanded = this.cleanParantheses(this.formula);
@@ -207,2 +209,2 @@ this.composition = this.formulaToJson(expanded);
 
-}
+}

package.json

 {
   "name": "molecular-formula",
-  "version": "1.1.4",
+  "version": "1.1.5",
   "description": "A library for working with molecular-formula",
@@ -28,3 +28,2 @@ "main": "index.js",
     "chai": "^4.1.2",
-    "fs": "0.0.1-security",
     "mocha": "^5.2.0"
@@ -31,0 +30,0 @@ },

README.md

 # molecular-formula
+
+[![Build Status](https://travis-ci.org/emptyport/molecular-formula.svg?branch=master)](https://travis-ci.org/emptyport/molecular-formula)
+[![codecov](https://codecov.io/gh/emptyport/molecular-formula/branch/master/graph/badge.svg)](https://codecov.io/gh/emptyport/molecular-formula)
+[![All Contributors](https://img.shields.io/badge/all_contributors-1-orange.svg?style=flat-square)](#contributors)
+[![License: MIT](https://img.shields.io/badge/License-MIT-yellow.svg)](https://opensource.org/licenses/MIT)
+
+
 A simple library to work with molecular formula.
@@ -17,2 +24,8 @@
 ```
+
+Subscripts are also now supported thanks to [AprilArcus](https://github.com/AprilArcus)!
+``` javascript
+var water = new molFormula('H₂O');
+```
+
 You can retrieve the original formula like so.
@@ -22,2 +35,3 @@ ``` javascript
 ```
+
 You also have access to the elemental composition.
@@ -27,2 +41,3 @@ ``` javascript
 ```
+
 Output:
@@ -76,2 +91,7 @@ ```
 
+## Contributors
+[<img src="https://avatars1.githubusercontent.com/u/2045543?s=400&v=4" width="75px;"/><br /><sub><b>April Arcus</b></sub>](https://github.com/AprilArcus)<br />
+[💻](https://github.com/emptyport/molecular-formula/commits?author=AprilArcus "Code")
+[⚠️](https://github.com/emptyport/molecular-formula/commits?author=AprilArcus "Tests")
+
 ## Future functionality
@@ -78,0 +98,0 @@ There are currently no planned improvements to this module. I am open to suggestions so let me know if you think something is missing.

test/test-index.js

@@ -35,11 +35,11 @@ var should = require('chai').should();
 
-  it('formula for H2O matches', function() {
+  it('formula for Na2(OH)2CH4(Na(Cl)2)2U(CN) matches', function() {
     formula.getFormula().should.equal('Na2(OH)2CH4(Na(Cl)2)2U(CN)');
   });
 
-  it('simplified formula for H2O matches', function() {
+  it('simplified formula for Na2(OH)2CH4(Na(Cl)2)2U(CN) matches', function() {
     formula.getSimplifiedFormula().should.equal('Na4O2H6C2Cl4UN');
   });
 
-  it('composition for H2O matches', function() {
+  it('composition for Na2(OH)2CH4(Na(Cl)2)2U(CN) matches', function() {
     var composition = formula.getComposition();
@@ -58,2 +58,27 @@ Object.keys(composition).length.should.equal(7);
 
+describe('Unicode Subscripts', function() {
+  formula = new molFormula('Na₂(OH)₂CH₄(Na(Cl)₂)₂U(CN)');
+
+  it('formula for Na₂(OH)₂CH₄(Na(Cl)₂)₂U(CN) matches', function() {
+    formula.getFormula().should.equal('Na2(OH)2CH4(Na(Cl)2)2U(CN)');
+  });
+
+  it('simplified formula for Na₂(OH)₂CH₄(Na(Cl)₂)₂U(CN) matches', function() {
+    formula.getSimplifiedFormula().should.equal('Na4O2H6C2Cl4UN');
+  });
+
+  it('composition for Na₂(OH)₂CH₄(Na(Cl)₂)₂U(CN) matches', function() {
+    var composition = formula.getComposition();
+    Object.keys(composition).length.should.equal(7);
+    composition['Na'].should.equal(4);
+    composition['O'].should.equal(2);
+    composition['H'].should.equal(6);
+    composition['C'].should.equal(2);
+    composition['Cl'].should.equal(4);
+    composition['U'].should.equal(1);
+    composition['N'].should.equal(1);
+    formula.getComposition().should.deep.equal({ Na: 4, O: 2, H: 6, C: 2, Cl: 4, U: 1, N: 1});
+  });
+});
+
 describe('Adding and Subtracting Formulae', function() {
@@ -106,2 +131,2 @@ methyl = new molFormula('CH3');
   });
-});
+});

No alert changes

Improved metrics

Total package byte prevSize

14954

increased by18.99%

Dev dependency count

2

decreased by-33.33%

Number of package files

6

increased by20%

Lines of code

286

increased by9.58%

Number of lines in readme file

101

increased by24.69%

No dependency changes